The H-cys(acm)-NH₂.HCL, with the CAS registry number 88530-32-9, is also known as (R)-3-(acetamidomethylthio)-2-aminopropanamide hydrochloride. It belongs to the product categories of Amino Acids Derivatives; Cysteine [Cys, C]; Amino Acids and Derivatives; Amino hydrochloride. This chemical's molecular formula is C₆H₁₄ClN₃O₂S and molecular weight is  227.71. What's more, its systematic name is (2R)-3-(acetamidomethylsulfanyl)-2-amino-propanamide hydrochloride.

Physical properties of H-cys(acm)-NH₂.HCL are: (1)# of Rule of 5 Violations: 1; (2)#H bond acceptors: 5; (3)#H bond donors: 5; (4)#Freely Rotating Bonds: 6; (5)Polar Surface Area: 123.51 Å²; (6)Flash Point: 254.9 °C; (7)Enthalpy of Vaporization: 78.04 kJ/mol; (8)Boiling Point: 497.8 °C at 760 mmHg; (9)Vapour Pressure: 2.74E-10 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: Cl.O=C(C)NCSC[C@H](N)C(N)=O
(2)InChI: InChI=1/C6H13N3O2S.ClH/c1-4(10)9-3-12-2-5(7)6(8)11;/h5H,2-3,7H2,1H3,(H2,8,11)(H,9,10);1H/t5-;/m0./s1
(3)InChIKey: ZRBPBPZOUBWCMM-JEDNCBNOBL