The Imidazo[1,2-a]pyridine-2-acetic acid ethyl ester, with the cas registry number 21755-34-0, has the systematic name of ethyl imidazo[1,2-a]pyridin-2-ylacetate. And the molecular formula of the chemical is C₁₁H₁₂N₂O₂. The chemical is harmful if swallowed, so you had better wear suitable protective clothing while you are dealing with it.

The characteristics of this chemical are as followings: (1)ACD/LogP: 1.38; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 43.6 Å²; (7)Index of Refraction: 1.583; (8)Molar Refractivity: 57.206 cm³; (9)Molar Volume: 171.065 cm³; (10)Polarizability: 22.678×10^-24cm³; (11)Surface Tension: 44.032 dyne/cm; (12)Density: 1.194 g/cm³.

Addtionally, the following datas could be converted into the molecular structure:
(1)SMILES: O=C(OCC)Cc1nc2ccccn2c1
(2)InChI: InChI=1/C11H12N2O2/c1-2-15-11(14)7-9-8-13-6-4-3-5-10(13)12-9/h3-6,8H,2,7H2,1H3
(3)InChIKey: CELPSGSLQYBSCR-UHFFFAOYAY