The L-Aspartic acid,3-hydroxy-, (3S)- with CAS registry number of 7298-99-9 is also known as (3S)-3-Hydroxyaspartic acid. The IUPAC name is (2S,3S)-2-Amino-3-hydroxybutanedioic acid. In addition, the formula is C₄H₇NO₅ and the molecular weight is 149.10. What's more, this chemical should be sealed in cool and dry place.

Physical properties about L-Aspartic acid,3-hydroxy-, (3S)- are: (1)ACD/LogP: -0.51; (2)# of Rule of 5 Violations: 1; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 6; (8)#H bond donors: 5; (9)#Freely Rotating Bonds: 5; (10)Index of Refraction: 1.583; (11)Molar Refractivity: 28.69 cm³; (12)Molar Volume: 85.7 cm³; (13)Surface Tension: 106.4 dyne/cm; (14)Density: 1.738 g/cm³; (15)Flash Point: 176.8 °C; (16)Enthalpy of Vaporization: 71.21 kJ/mol; (17)Boiling Point: 368.7 °C at 760 mmHg; (18)Vapour Pressure: 6.2E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C(C(C(=O)O)O)(C(=O)O)N
2. Isomeric SMILES: [C@H]([C@@H](C(=O)O)O)(C(=O)O)N
3. InChI: InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/t1-,2-/m0/s1
4. InChIKey: YYLQUHNPNCGKJQ-LWMBPPNESA-N