The Methacryloylamionpropyltrimethylammonium methyl sulphate, with the CAS registry number 51441-65-7, is also known as Trimethyl(2-((2-methyl-1-oxoallyl)amino)propyl)ammonium methyl sulphate. Its EINECS number is 257-207-6. This chemical's molecular formula is C₁₁H₂₄N₂O₅S and molecular weight is 296.38. What's more, its systematic name is 2-(Methacryloylamino)-N,N,N-trimethyl-1-propanaminium methyl sulfate.

Physical properties of Methacryloylamionpropyltrimethylammonium methyl sulphate are: (1)ACD/LogP: -3.583; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.58; (4)ACD/LogD (pH 7.4): -3.58; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 1.00; (7)ACD/KOC (pH 5.5): 1.00; (8)ACD/KOC (pH 7.4): 1.00; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 20.31 Å².

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(NC(C)C[N+](C)(C)C)\C(=C)C.[O-]S(=O)(=O)OC
(2)Std. InChI: InChI=1S/C10H20N2O.CH4O4S/c1-8(2)10(13)11-9(3)7-12(4,5)6;1-5-6(2,3)4/h9H,1,7H2,2-6H3;1H3,(H,2,3,4)
(3)Std. InChIKey: IWQBMGQYDRKEHS-UHFFFAOYSA-N