Products Categories
| CAS No.: | 4510-08-1 |
|---|---|
| Name: | H-MET-NH2 |
| Molecular Structure: | |
|
|
|
| Formula: | C5H12N2OS |
| Molecular Weight: | 148.229 |
| Synonyms: | Methioninamide, L- (8CI);L-Methioninamide;L-Methionine amide;H-Met-NH2; |
| Density: | 1.141 g/cm3 |
| Boiling Point: | 332.7 °C at 760 mmHg |
| Flash Point: | 155 °C |
| PSA: | 94.41000 |
| LogP: | 0.95270 |
This chemical is called Butanamide, 2-amino-4-(methylthio)-, (2S)-, and its systematic name is L-methioninamide. With the molecular formula of C5H12N2OS, its molecular weight is 148.23. The CAS registry number of this chemical is 4510-08-1. Additionally, its product categories are Methionine [Met, M]; Amino Acids and Derivatives.
Other characteristics of the Butanamide, 2-amino-4-(methylthio)-, (2S)- can be summarised as followings: (1)ACD/LogP: -0.53; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.95; (4)ACD/LogD (pH 7.4): -0.65; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 9.27; (9)#H bond acceptors: 3; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 48.85 Å2; (13)Index of Refraction: 1.532; (14)Molar Refractivity: 40.26 cm3; (15)Molar Volume: 129.8 cm3; (16)Polarizability: 15.96×10-24cm3; (17)Surface Tension: 48.2 dyne/cm; (18)Density: 1.141 g/cm3; (19)Flash Point: 155 °C; (20)Enthalpy of Vaporization: 57.55 kJ/mol; (21)Boiling Point: 332.7 °C at 760 mmHg; (22)Vapour Pressure: 0.000143 mmHg at 25°C.
You can still convert the following datas into molecular structure:
1.SMILES: O=C(N)[C@@H](N)CCSC
2.InChI: InChI=1/C5H12N2OS/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H2,7,8)/t4-/m0/s1
3.InChIKey: GSYTVXOARWSQSV-BYPYZUCNBP