The Methyl 4-Aminocinnamate, with the CAS registry number 66417-26-3, is also known as 2-Propenoic acid, 3-(4-aminophenyl)-, methyl ester, (2E)-. This chemical's molecular formula is C₁₀H₁₁NO₂ and molecular weight is 177.1998. Its systematic name is called methyl (2E)-3-(4-aminophenyl)prop-2-enoate.

Physical properties of Methyl 4-Aminocinnamate: (1)ACD/LogP: 0.90; (2)ACD/LogD (pH 5.5): 0.89; (3)ACD/LogD (pH 7.4): 0.89; (4)ACD/BCF (pH 5.5): 2.81; (5)ACD/BCF (pH 7.4): 2.82; (6)ACD/KOC (pH 5.5): 72.88; (7)ACD/KOC (pH 7.4): 73.05; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.607; (12)Molar Refractivity: 52.78 cm³; (13)Molar Volume: 152.6 cm³; (14)Surface Tension: 47.3 dyne/cm; (15)Density: 1.16 g/cm³; (16)Flash Point: 183.7 °C; (17)Enthalpy of Vaporization: 57.83 kJ/mol; (18)Boiling Point: 335.3 °C at 760 mmHg; (19)Vapour Pressure: 0.000121 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OC)/C=C/c1ccc(N)cc1
(2)InChI: InChI=1/C10H11NO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,11H2,1H3/b7-4+
(3)InChIKey: HYVLKRMLVXUWQE-QPJJXVBHBM