The N-[(1R)-2-[3-(Aminosulfonyl)-4-methoxyphenyl]-1-methylethyl]acetamide is a kind of organic compounds with cas registry number of 112101-74-3. Both its systematic name and IUPAC name are the same which is called N-[(2R)-1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl]acetamide.

The physical properties about this chemical are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 12.63; (4)ACD/KOC (pH 7.4): 12.6; (5)#H bond acceptors: 6; (6)#H bond donors: 3; (7)#Freely Rotating Bonds: 5 ; (8)Index of Refraction: 1.539; (9)Molar Refractivity: 72.44 cm³; (10)Molar Volume: 231 cm³; (11)Surface Tension: 45.9 dyne/cm; (12)Density: 1.239 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(c1cc(ccc1OC)C[C@H](NC(=O)C)C)N;
(2)InChI: InChI=1/C12H18N2O4S/c1-8(14-9(2)15)6-10-4-5-11(18-3)12(7-10)19(13,16)17/h4-5,7-8H,6H2,1-3H3,(H,14,15)(H2,13,16,17)/t8-/m1/s1;
(3)InChIKey: KDHJIWMGQFZAOV-MRVPVSSYBO