The 2-Propenamide,N-(2,2-dimethoxyethyl)-2-methyl- is an organic compound that the formula C₈H₁₅NO₃. With the CAS Registry Number 95984-11-5 and EINECS 306-091-6, the IUPAC name of this chemical is N-(2,2-dimethoxyethyl)-2-methylprop-2-enamide. When use it, people should be careful.

The other characteristics of 2-Propenamide,N-(2,2-dimethoxyethyl)-2-methyl- can be summarized as: (1)ACD/LogP: 0.36; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.36; (4)ACD/LogD (pH 7.4): 0.36; (5)ACD/BCF (pH 5.5): 1.1; (6)ACD/BCF (pH 7.4): 1.1; (7)ACD/KOC (pH 5.5): 37.32; (8)ACD/KOC (pH 7.4): 37.32; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 5; (12)Index of Refraction: 1.437; (13)Molar Refractivity: 45.75 cm³; (14)Molar Volume: 174.5 cm³; (15)Polarizability: 18.13×10^-24 cm³; (16)Surface Tension: 29.1 dyne/cm; (17)Enthalpy of Vaporization: 54.43 kJ/mol; (18)Vapour Pressure: 0.000899 mmHg at 25°C; (19)Rotatable Bond Count: 5; (20)Tautomer Count: 2; (21)Exact Mass: 173.105193; (22)MonoIsotopic Mass: 173.105193; (23)Topological Polar Surface Area: 47.6; (24)Heavy Atom Count: 12; (25)Complexity: 164.

People can use the following data to convert to the molecule structure.
1. SMILES:O=C(NCC(OC)OC)\C(=C)C
2. InChI:InChI=1/C8H15NO3/c1-6(2)8(10)9-5-7(11-3)12-4/h7H,1,5H2,2-4H3,(H,9,10) 
3. InChIKey:MGARLISKINLYPI-UHFFFAOYAC
4. Std. InChI:InChI=1S/C8H15NO3/c1-6(2)8(10)9-5-7(11-3)12-4/h7H,1,5H2,2-4H3,(H,9,10) 
5. Std. InChIKey:MGARLISKINLYPI-UHFFFAOYSA-N