The N,N'-(Methylenedi-p-phenylene)bis(aziridine-1-carboxamide), with the CAS registry number 7417-99-4, is also known as 4,4'-Bis(ethyleneiminocarbonylamino)diphenylmethane. Its EINECS number is 231-034-6. This chemical's molecular formula is C₁₉H₂₀N₄O₂ and molecular weight is 336.39. What's more, its systematic name is N,N'-(Methylenedi-4,1-phenylene)bis(1-aziridinecarboxamide).

Physical properties of N,N'-(Methylenedi-p-phenylene)bis(aziridine-1-carboxamide) are: (1)ACD/LogP: -0.326; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.33; (4)ACD/LogD (pH 7.4): -0.33; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 1.00; (7)ACD/KOC (pH 5.5): 15.84; (8)ACD/KOC (pH 7.4): 15.84; (9)#H bond acceptors: 6; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 64.22 Å²; (13)Index of Refraction: 1.751; (14)Molar Refractivity: 96.147 cm³; (15)Molar Volume: 235.755 cm³; (16)Polarizability: 38.116×10^-24cm³; (17)Surface Tension: 84.6 dyne/cm; (18)Density: 1.427 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(Nc1ccc(cc1)Cc3ccc(NC(=O)N2CC2)cc3)N4CC4
(2)Std. InChI: InChI=1S/C19H20N4O2/c24-18(22-9-10-22)20-16-5-1-14(2-6-16)13-15-3-7-17(8-4-15)21-19(25)23-11-12-23/h1-8H,9-13H2,(H,20,24)(H,21,25)
(3)Std. InChIKey: XECQDYXJWMHGBI-UHFFFAOYSA-N