Products Categories
| CAS No.: | 4273-92-1 |
|---|---|
| Name: | Naphthol AS-LC |
| Molecular Structure: | |
|
|
|
| Formula: | C19H16ClNO4 |
| Molecular Weight: | 357.793 |
| Synonyms: | 2-Naphthanilide,4'-chloro-3-hydroxy-2',5'-dimethoxy- (6CI,7CI,8CI);2-Hydroxy-3-naphthoylamino-2',5'-dimethoxy-4-chloroanilide;2-Hydroxynaphthalene-3-carboxylic acid-2',5'-dimethoxy-4'-chlorophenylamide;Anarthol AS-LC;C.I. 37555;C.I. Azoic Coupling Component 23;Conazoic BC;Dycosthol AS-LC;Kiwa Grounder LC;N-(2',5'-Dimethoxy-4'-chlorophenyl)-3-hydroxy-2-naphthalenecarboxamide;NSC 50688;NSC 73118;Naftol AS-LC;Naphtanilide LC;Naphtazol LC;Naphthol AS-LC;Naphthol LC;Sanatol LC; |
| EINECS: | 224-270-6 |
| Density: | 1.372 g/cm3 |
| Melting Point: | 190°C |
| Boiling Point: | 479.803 °C at 760 mmHg |
| Flash Point: | 243.976 °C |
| Appearance: | light yellow powder |
| PSA: | 67.79000 |
| LogP: | 4.54130 |
The Naphthol AS-LC, with the CAS registry number 4273-92-1, is also known as 2-Hydroxy-3-naphthoylamino-2',5'-dimethoxy-4-chloroanilide. It belongs to the product categories of Intermediates of Dyes and Pigments; Organics. Its EINECS number is 224-270-6. This chemical's molecular formula is C19H16ClNO4 and molecular weight is 357.79. What's more, its systematic name is N-(4-Chloro-2,5-dimethoxyphenyl)-3-hydroxy-2-naphthamide. This chemical is mainly used for dyeing of cotton, viscose fiber, silk, nylon and polyester.
Physical properties of Naphthol AS-LC are: (1)ACD/LogP: 5.203; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.20; (4)ACD/LogD (pH 7.4): 5.16; (5)ACD/BCF (pH 5.5): 5297.01; (6)ACD/BCF (pH 7.4): 4796.19; (7)ACD/KOC (pH 5.5): 16109.65; (8)ACD/KOC (pH 7.4): 14586.53; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 67.79 Å2; (13)Index of Refraction: 1.682; (14)Molar Refractivity: 98.805 cm3; (15)Molar Volume: 260.805 cm3; (16)Polarizability: 39.169×10-24cm3; (17)Surface Tension: 56.5 dyne/cm; (18)Density: 1.372 g/cm3; (19)Flash Point: 243.976 °C; (20)Enthalpy of Vaporization: 77.255 kJ/mol; (21)Boiling Point: 479.803 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Clc1cc(OC)c(cc1OC)NC(=O)c3cc2ccccc2cc3O
(2)Std. InChI: InChI=1S/C19H16ClNO4/c1-24-17-10-15(18(25-2)9-14(17)20)21-19(23)13-7-11-5-3-4-6-12(11)8-16(13)22/h3-10,22H,1-2H3,(H,21,23)
(3)Std. InChIKey: QIHKTBRNOLQDGQ-UHFFFAOYSA-N