Products Categories
| CAS No.: | 13063-04-2 |
|---|---|
| Name: | Nitidine chloride |
| Molecular Structure: | |
|
|
|
| Formula: | C21H18ClNO4 |
| Molecular Weight: | 383.831 |
| Synonyms: | 2,3-Dimethoxy-12-methyl-(1,3)-benzodioxolo(5,6-c)phenanthridinium chloride;Nitidine, chloride (8CI); |
| EINECS: | 300-009-4 |
| Density: | 1.35g/cm3 |
| Melting Point: | 281-282oC |
| Boiling Point: | 619oC at 760 mmHg |
| Flash Point: | 189.4oC |
| Safety: | 24/25 |
| PSA: | 40.80000 |
| LogP: | 3.71660 |
The Nitidine chloride, with the CAS registry number of 13063-04-2, is also known as 2,3-Dimethoxy-12-methyl-[1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-12-ium. This chemical's molecular formula is C21H18ClNO4 and molecular weight is 406.39. What's more, its IUPAC name is 2,3-Dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium. This chemical's classification code is Mutation data.
Physical properties about the Nitidine chloride are: (1)#H bond acceptors: 5; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 40.8 Å2.
You can still convert the following datas into molecular structure:
(1) SMILES:[Cl-].O1c3c(OC1)cc2ccc4c5c(c[n+](c4c2c3)C)cc(OC)c(OC)c5
(2) InChI:InChI=1/C21H18NO4.ClH/c1-22-10-13-7-17(23-2)18(24-3)8-15(13)14-5-4-12-6-19-20(26-11-25-19)9-16(12)21(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1
(3) InChIKey:QLDAACVSUMUMOR-REWHXWOFAP
The toxicity data is as follows:
Organism Test Type Route Reported Dose (Normalized Dose) Effect Source mouse LD50 intraperitoneal 98980ug/kg (98.98mg/kg) National Cancer Institute Screening Program Data Summary, Developmental Therapeutics Program. Vol. JAN1986,