The PAM-sulfonat [German], with the CAS registry number 102584-02-1, is also known as Pyridinium, 2-formyl-1-methyl-, sulfonate, oxime. This chemical's molecular formula is C₇H₈N₂O₄S and molecular weight is 216.21442. Its IUPAC name is called (2Z)-1-methyl-2-(oxoazaniumylmethylidene)pyridine-3-sulfonate. This chemical's classification codes are Agricultural Chemical; Drug / Therapeutic Agent.

Physical properties of PAM-sulfonat [German]: (1)XLogP3-AA: -0.7; (2)H-Bond Donor: 1; (3)H-Bond Acceptor: 5; (4)Rotatable Bond Count: 1; (5)Exact Mass: 216.020477; (6)MonoIsotopic Mass: 216.020477; (7)Topological Polar Surface Area: 99.9; (8)Heavy Atom Count: 14; (9)Formal Charge: 0; (10)Complexity: 414; (11)Isotope Atom Count: 0; (12)Defined Atom StereoCenter Count: 0; (13)Undefined Atom StereoCenter Count: 0; (14)Defined Bond StereoCenter Count: 1; (15)Undefined Bond StereoCenter Count: 0; (16)Covalently-Bonded Unit Count: 1.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CN1C=CC=C(C1=C[NH+]=O)S(=O)(=O)[O-]
(2)Isomeric SMILES: CN\1C=CC=C(/C1=C/[NH+]=O)S(=O)(=O)[O-]
(3)InChI: InChI=1S/C7H8N2O4S/c1-9-4-2-3-7(14(11,12)13)6(9)5-8-10/h2-5H,1H3,(H,11,12,13)/b6-5-
(4)InChIKey: JDKKGHHGWQJGCX-WAYWQWQTSA-N

The toxicity data is as follows: