The Pterolactam, with the CAS registry number 38072-88-7, is also known as 5-Methoxy-2-pyrrolidinone. This chemical's molecular formula is C₅H₉NO₂ and molecular weight is 115.1305. Its IUPAC name is called 5-methoxypyrrolidin-2-one.

Physical properties of Pterolactam: (1)ACD/LogP: -2.18; (2)ACD/LogD (pH 5.5): -2.18; (3)ACD/LogD (pH 7.4): -2.18; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1.55; (7)ACD/KOC (pH 7.4): 1.55; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.46; (12)Molar Refractivity: 28.63 cm³; (13)Molar Volume: 104.4 cm³; (14)Surface Tension: 34 dyne/cm; (15)Density: 1.1 g/cm³; (16)Flash Point: 116.2 °C; (17)Enthalpy of Vaporization: 50.66 kJ/mol; (18)Boiling Point: 268.5 °C at 760 mmHg; (19)Vapour Pressure: 0.00767 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1CCC(=O)N1
(2)InChI: InChI=1S/C5H9NO2/c1-8-5-3-2-4(7)6-5/h5H,2-3H2,1H3,(H,6,7)
(3)InChIKey: VULIHENHKGDFAB-UHFFFAOYSA-N