The Phenanthren-9-ylmethanol, with the CAS registry number 4707-72-6, is also known as 9-Phenanthrenemethanol. This chemical's molecular formula is C₁₅H₁₂O and molecular weight is 208.26. Its IUPAC name is called phenanthren-9-ylmethanol.

Physical properties of Phenanthren-9-ylmethanol: (1)ACD/LogP: 3.50; (2)#H bond acceptors: 1; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Index of Refraction: 1.729; (6)Molar Refractivity: 68.38 cm³; (7)Molar Volume: 171.4 cm³; (8)Surface Tension: 55.7 dyne/cm; (9)Density: 1.214 g/cm³; (10)Flash Point: 196.3 °C; (11)Enthalpy of Vaporization: 71.45 kJ/mol; (12)Boiling Point: 423.4 °C at 760 mmHg; (13)Vapour Pressure: 6.35E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)CO
(2)InChI: InChI=1S/C15H12O/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9,16H,10H2
(3)InChIKey: YTBUBUXQLGFKKL-UHFFFAOYSA-N