The Phenindamine hydrogen tartrate with CAS registry number of 569-59-5 is also known as 1H-Indeno(2,1-c)pyridine, 2,3,4,9-tetrahydro-2-methyl-9-phenyl-, tartrate (1:1). The IUPAC name is 2,3-Dihydroxybutanedioic acid;2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine. Its EINECS registry number is 209-320-7. In addition, the formula is C₁₉H₁₉N•C₄H₆O₆ and the molecular weight is 411.45.

Physical properties about Phenindamine hydrogen tartrate are: (1)ACD/LogP: 3.50; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.76; (4)ACD/LogD (pH 7.4): 2.38; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 20.7; (7)ACD/KOC (pH 5.5): 3.49; (8)ACD/KOC (pH 7.4): 147.17; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 3.24Ų; (13)Flash Point: 183 °C; (14)Enthalpy of Vaporization: 66.98 kJ/mol; (15)Boiling Point: 416.5 °C at 760 mmHg; (16)Vapour Pressure: 3.8E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. SMILES: O=C(O)[C@H](O)[C@@H](O)C(=O)O.c41c(\C3=C(/C1c2ccccc2)CN(CC3)C)cccc4
2. InChI: InChI=1/C19H19N.C4H6O6/c1-20-12-11-16-15-9-5-6-10-17(15)19(18(16)13-20)14-7-3-2-4-8-14;5-1(3(7)8)2(6)4(9)10/h2-10,19H,11-13H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
3. InChIKey: WFXURHIXPXVPGM-LREBCSMRBF

The toxicity data is as follows: