Products Categories
| CAS No.: | 22139-77-1 |
|---|---|
| Name: | PINOSYLVIN |
| Molecular Structure: | |
|
|
|
| Formula: | C14H12O2 |
| Molecular Weight: | 212.248 |
| Synonyms: | 1,3-Benzenediol,5-(2-phenylethenyl)-, (E)-;3,5-Stilbenediol, (E)- (8CI);3,5-Dihydroxy-trans-stilbene;Pinosylvin;Pinosylvine;trans-3,5-Dihydroxystilbene; |
| EINECS: | 683-184-0 |
| Density: | 1.252g/cm3 |
| Melting Point: | 155.5-156° |
| Boiling Point: | 397.6 °C at 760 mmHg |
| Flash Point: | 195 °C |
| Hazard Symbols: | Xn,N |
| Risk Codes: | 22-36-51/53 |
| Safety: | 26-61 |
| PSA: | 40.46000 |
| LogP: | 3.26820 |
The Pinosylvin with the CAS number 22139-77-1 is also called 1,3-Benzenediol,5-[(1E)-2-phenylethenyl]-. Both the systematic name and IUPAC name are 5-[(E)-2-phenylethenyl]benzene-1,3-diol. Its molecular formula is C14H12O2. The product category is Stilbenes (substituted).
The properties of the chemical are: (1)ACD/LogP: 3.68; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.68; (4)ACD/LogD (pH 7.4): 3.67; (5)ACD/BCF (pH 5.5): 366.07; (6)ACD/BCF (pH 7.4): 361.99; (7)ACD/KOC (pH 5.5): 2380.03; (8)ACD/KOC (pH 7.4): 2353.54; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 18.46 Å2; (13)Index of Refraction: 1.726; (14)Molar Refractivity: 67.4 cm3; (15)Molar Volume: 169.5 cm3; (16)olarizability: 26.72×10-24cm3; (17)Surface Tension: 60.1 dyne/cm; (18)Enthalpy of Vaporization: 67.33 kJ/mol; (19)Vapour Pressure: 6.85×10-7 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Oc2cc(\C=C\c1ccccc1)cc(O)c2
(2)InChI: InChI=1/C14H12O2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-10,15-16H/b7-6+
(3)InChIKey: YCVPRTHEGLPYPB-VOTSOKGWBH
The toxicity data is as follows:
| Organism | Test Type | Route | Reported Dose (Normalized Dose) | Effect | Source |
|---|---|---|---|---|---|
| mouse | LD50 | intraperitoneal | 20mg/kg (20mg/kg) | "CRC Handbook of Antibiotic Compounds," Vols.1- , Berdy, J., Boca Raton, FL, CRC Press, 1980Vol. 8(2), Pg. 300, 1982. |