The CAS registry number of Propanoic acid,3-(2-aminophenoxy)- is 6303-99-7. This chemical is also named as NSC41446. In addition, its molecular formula is C₉H₁₁NO₃ and molecular weight is 181.1885. Its systematic name and IUPAC name are the same which is called 3-(2-aminophenoxy)propanoic acid.

Physical properties about Propanoic acid,3-(2-aminophenoxy)- are: (1)ACD/LogP: 0.59; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 5; (6)Index of Refraction: 1.584; (7)Molar Refractivity: 47.99 cm³; (8)Molar Volume: 143.3 cm³; (9)Surface Tension: 55.4 dyne/cm; (10)Density: 1.263 g/cm³; (11)Flash Point: 158.3 °C; (12)Enthalpy of Vaporization: 61.37 kJ/mol; (13)Boiling Point: 338.2 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)CCOc1ccccc1N
(2)InChI: InChI=1/C9H11NO3/c10-7-3-1-2-4-8(7)13-6-5-9(11)12/h1-4H,5-6,10H2,(H,11,12)
(3)InChIKey: NTKUIDWWNRLAGS-UHFFFAOYAZ