The Quinoxaline,6-methoxy-2,3-dimethyl-, with the CAS registry number 6637-22-5, is also known as 2,3-Dimethyl-6-methoxyquinoxaline. Its EINECS registry number is 229-636-9. This chemical's molecular formula is C₁₁H₁₂N₂O and molecular weight is 188.23. Its IUPAC name is called 6-methoxy-2,3-dimethylquinoxaline.

Physical properties of Quinoxaline,6-methoxy-2,3-dimethyl-: (1)ACD/LogP: 2.64; (2)ACD/LogD (pH 5.5): 2.64; (3)ACD/LogD (pH 7.4): 2.64; (4)ACD/BCF (pH 5.5): 60.07; (5)ACD/BCF (pH 7.4): 60.08; (6)ACD/KOC (pH 5.5): 652.76; (7)ACD/KOC (pH 7.4): 652.89; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.595; (11)Molar Refractivity: 56.6 cm³; (12)Molar Volume: 166.5 cm³; (13)Surface Tension: 44.9 dyne/cm; (14)Density: 1.13 g/cm³; (15)Flash Point: 103.5 °C; (16)Enthalpy of Vaporization: 51.93 kJ/mol; (17)Boiling Point: 300.8 °C at 760 mmHg; (18)Vapour Pressure: 0.00195 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=NC2=C(C=C(C=C2)OC)N=C1C
(2)InChI: InChI=1S/C11H12N2O/c1-7-8(2)13-11-6-9(14-3)4-5-10(11)12-7/h4-6H,1-3H3
(3)InChIKey: QWGMPWRVGQLNHK-UHFFFAOYSA-N