The R-3,3'-Diiodo-2,2'-bis(methoxymethoxy)-1,1'-binaphthalene, with the CAS registry number 189518-78-3, is also known as (R)-2,2'-Bis(methoxymethoxy)-3,3'-diiodo-1,1'-binaphthyl. This chemical's molecular formula is C₂₄H₂₀I₂O₄ and molecular weight is 626.22. What's more, its systematic name is R-3,3'-Diiodo-2,2'-bis(methoxymethoxy)-1,1'-binaphthalene.

Physical properties of R-3,3'-Diiodo-2,2'-bis(methoxymethoxy)-1,1'-binaphthalene are: (1)ACD/LogP: 6.617; (2)# of Rule of 5 Violations: 2; (3)ACD/LogD (pH 5.5): 6.62; (4)ACD/LogD (pH 7.4): 6.62; (5)ACD/BCF (pH 5.5): 62885.24; (6)ACD/BCF (pH 7.4): 62885.24; (7)ACD/KOC (pH 5.5): 94707.04; (8)ACD/KOC (pH 7.4): 94707.04; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 36.92 Å²; (13)Index of Refraction: 1.693; (14)Molar Refractivity: 138.457 cm³; (15)Molar Volume: 360.838 cm³; (16)Polarizability: 54.889×10^-24cm³; (17)Surface Tension: 52.6 dyne/cm; (18)Density: 1.735 g/cm³; (19)Flash Point: 310.775 °C; (20)Enthalpy of Vaporization: 84.817 kJ/mol; (21)Boiling Point: 590.255 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Ic2cc1c(cccc1)c(c2OCOC)c4c3ccccc3cc(I)c4OCOC
(2)Std. InChI: InChI=1S/C24H20I2O4/c1-27-13-29-23-19(25)11-15-7-3-5-9-17(15)21(23)22-18-10-6-4-8-16(18)12-20(26)24(22)30-14-28-2/h3-12H,13-14H2,1-2H3
(3)Std. InChIKey: HVIYMUMYPJXEAR-UHFFFAOYSA-N