The Sodium undecylenate, with the CAS registry number 3398-33-2, is also known as 10-Undecenoic, sodium salt. Its EINECS number is 222-264-8. This chemical's molecular formula is C₁₁H₂₀NaO₂ and molecular weight is 207.26. What's more, its IUPAC name is sodium; undec-10-enoic acid. 

Physical properties of Sodium undecylenate are: (1)ACD/LogP: 3.99; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.19; (4)ACD/LogD (pH 7.4): 1.4; (5)ACD/BCF (pH 5.5): 100.79; (6)ACD/BCF (pH 7.4): 1.62; (7)ACD/KOC (pH 5.5): 561.44; (8)ACD/KOC (pH 7.4): 9.01; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 9; (12)Polar Surface Area: 37.3 Å²; (13)Flash Point: 145.8 °C; (14)Enthalpy of Vaporization: 59.5 kJ/mol; (15)Boiling Point: 300.8 °C at 760 mmHg; (16)Vapour Pressure: 0.000257 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C=CCCCCCCCCC(=O)O.[Na]
(2)InChI: InChI=1S/C11H20O2.Na/c1-2-3-4-5-6-7-8-9-10-11(12)13;/h2H,1,3-10H2,(H,12,13);/q;+1/p-1
(3)InChIKey: GFPFFNIMDXSBHA-UHFFFAOYSA-N