The Tetrazolo[1,5-a]pyridine,6-bromo- has the CAS registry number 35235-74-6. It belongs to the product categories of Blocks; Bromides; Imidazoles; Pyridines. This chemical's molecular formula is C₅H₃BrN₄ and molecular weight is 199.008. What's more, its systematic name is 6-bromotetrazolo[1,5-a]pyridine. 

Physical properties of Tetrazolo[1,5-a]pyridine,6-bromo- are: (1)ACD/LogP: 0.67; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/BCF (pH 5.5): 4; (5)ACD/KOC (pH 5.5): 93; (6)#H bond acceptors: 4; (7)#H bond donors: 0; (8)#Freely Rotating Bonds: 0; (9)Polar Surface Area: 43.08 Å²; (10)Index of Refraction: 1.835; (11)Molar Refractivity: 41.16 cm³; (12)Molar Volume: 93.322 cm³; (13)Surface Tension: 75.13 dyne/cm; (14)Density: 2.133 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: Brc1ccc2nnnn2c1
(2)InChI: InChI=1S/C5H3BrN4/c6-4-1-2-5-7-8-9-10(5)3-4/h1-3H
(3)InChIKey: BZQNWLUCQRIYFF-UHFFFAOYSA-N