Cascade energy transfer refers to a series of energy transfer processes that occur in a sequential manner. In the context of EBSPCs, this typically involves the efficient transfer of absorbed energy from one molecular unit to another within the same molecule or in a complex, leading to a cascading effect. This can result in the efficient harvesting and utilization of light energy, making EBSPCs potentially useful in applications like organic photovoltaics (solar cells) and light-emitting diodes (OLEDs).
If you need to purchase chemical raw materials, submit your demand information to get the latest quotations.
B(C6H4C2N2)3(CCC16H8CCC6H2(OC16H33)3)
3-bromodibenzo[g,p]chrysene
