The Trimethobenzamide, with the CAS registry number 138-56-7, is also known as 4-(2-Dimethylaminoethoxy)-N-(3,4,5-trimethoxybenzoyl)benzylamine. Its EINECS registry number is 205-332-1. This chemical's molecular formula is C₂₁H₂₈N₂O₅ and molecular weight is 388.46. Its IUPAC name is called N-[[4-(2-dimethylaminoethyloxy)phenyl]methyl]-3,4,5-trimethoxybenzamide. This chemical's classification codes are Antiemetics; Autonomic Agents; Central Nervous System Agents; Gastrointestinal Agents; Peripheral Nervous System Agents. This chemical is an antiemetic used to prevent nausea and vomiting. Trimethobenzamide is generally considered the most potent antiemetic that does not have effects on the serotonergic, dopaminergic, or histaminergic systems, so it has a lower likelihood of causing undesired side effects.

Physical properties of Trimethobenzamide: (1)ACD/LogP: 1.85; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.96; (4)ACD/LogD (pH 7.4): 0.6; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 13.58; (9)#H bond acceptors: 7; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 10; (12)Index of Refraction: 1.546; (13)Molar Refractivity: 108.69 cm³; (14)Molar Volume: 343.2 cm³; (15)Surface Tension: 40.1 dyne/cm; (16)Density: 1.131 g/cm³; (17)Flash Point: 260.4 °C; (18)Enthalpy of Vaporization: 77.69 kJ/mol; (19)Boiling Point: 506.9 °C at 760 mmHg; (20)Vapour Pressure: 2.13E-10 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CN(C)CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C(=C2)OC)OC)OC
(2)InChI: InChI=1S/C21H28N2O5/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24)
(3)InChIKey: FEZBIKUBAYAZIU-UHFFFAOYSA-N