The beta-d-Fructofuranose, with the CAS registry number 53188-23-1, is also known as D(-)-Fructose. This chemical's molecular formula is C₆H₁₂O₆ and molecular weight is 180.16. What's more, its IUPAC name is (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-2,3,4-triol. 

Physical properties of beta-d-Fructofuranose are: (1)ACD/LogP: -1.47; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 6; (4)#H bond donors: 5; (5)#Freely Rotating Bonds: 7; (6)Polar Surface Area: 55.38 Å²; (7)Index of Refraction: 1.616; (8)Molar Refractivity: 37.18 cm³; (9)Molar Volume: 106.2 cm³; (10)Polarizability: 14.74×10^-24cm³; (11)Surface Tension: 94.5 dyne/cm; (12)Density: 1.694 g/cm³; (13)Flash Point: 220 °C; (14)Enthalpy of Vaporization: 80.46 kJ/mol; (15)Boiling Point: 440.1 °C at 760 mmHg; (16)Vapour Pressure: 1.36E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C(C1C(C(C(O1)(CO)O)O)O)O
(2)Isomeric SMILES: C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)O
(3)InChI: InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2/t3-,4-,5+,6-/m1/s1
(4)InChIKey: RFSUNEUAIZKAJO-ARQDHWQXSA-N

The toxicity data is as follows: