Products Categories
CAS No.: | 104944-18-5 |
---|---|
Name: | H-D-Val-OtBu.HCl |
Article Data: | 1 |
Molecular Structure: | |
Formula: | C9H20ClNO2 |
Molecular Weight: | 209.716 |
Synonyms: | D-Valine,1,1-dimethylethyl ester, hydrochloride (9CI);D-Valine tert-butyl esterhydrochloride; |
Melting Point: | 144-146 °C |
PSA: | 52.32000 |
LogP: | 2.81370 |
The D-Valine tert-butyl ester hydrochloride, with CAS registry number 104944-18-5, has the systematic name of tert-butyl (2R)-2-amino-3-methyl-butanoate hydrochloride. Besides this, it is also called (R)-tert-butyl 2-amino-3-methylbutanoate hydrochloride. This chemical should be stored at the temperature of 0°C.
You can still convert the following datas into molecular structure:
(1)SMILES: CC(C)[C@H](C(=O)OC(C)(C)C)N.Cl
(2)InChI: InChI=1/C9H19NO2.ClH/c1-6(2)7(10)8(11)12-9(3,4)5;/h6-7H,10H2,1-5H3;1H/t7-;/m1./s1
(3)InChIKey: AUIVQIHTTVPKFS-OGFXRTJIBI
(4)Std. InChI: InChI=1S/C9H19NO2.ClH/c1-6(2)7(10)8(11)12-9(3,4)5;/h6-7H,10H2,1-5H3;1H/t7-;/m1./s1
(5)Std. InChIKey: AUIVQIHTTVPKFS-OGFXRTJISA-N