Products Categories
CAS No.: | 10521-49-0 |
---|---|
Name: | GLYCYL-D-VALINE |
Article Data: | 2 |
Molecular Structure: | |
Formula: | C7H14N2O3 |
Molecular Weight: | 174.2 |
Synonyms: | D-Valine,N-glycyl-;Valine, N-glycyl-, D- (8CI);Glycyl-D-valine;NSC 522444; |
EINECS: | 217-806-5 |
Density: | 1.168 g/cm3 |
Melting Point: | 248ºC |
Boiling Point: | 405 °C at 760 mmHg |
Flash Point: | 198.8 °C |
PSA: | 92.42000 |
LogP: | 0.26170 |
<html dir="ltr"> <head> <title></title> </head> <body> <p>The D-Valine, glycyl-, with the CAS registry number 10521-49-0, is also known as Glycyl-D-valine. It belongs to the product categories of Amino Acid Derivatives; Biochemistry; Oligopeptides; Peptide Synthesis. This chemical's molecular formula is C<sub>7</sub>H<sub>14</sub>N<sub>2</sub>O<sub>3</sub> and molecular weight is 174.19766. Its systematic name is called (2R)-2-[(ammonioacetyl)amino]-3-methylbutanoate.&nbsp;What's more, the product should be sealed and stored in cool and dry place at temperature of -15 &deg;C.</p> <p>Physical properties of D-Valine, glycyl-: (1)ACD/LogP: -0.63; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 5; (7)#H bond donors: 4; (8)#Freely Rotating Bonds: 5; (9)Index of Refraction: 1.49; (10)Molar Refractivity: 43.12 cm<sup>3</sup>; (11)Molar Volume: 149 cm<sup>3</sup>; (12)Surface Tension: 46.4 dyne/cm; (13)Density: 1.168 g/cm<sup>3</sup>; (14)Flash Point: 198.8 &deg;C; (15)Enthalpy of Vaporization: 72.04 kJ/mol; (16)Boiling Point: 405 &deg;C at 760 mmHg; (17)Vapour Pressure: 1.08E-07 mmHg at 25&deg;C.</p> <p>You can still convert the following datas into molecular structure:<br /> (1)Canonical SMILES: CC(C)C(C(=O)O)NC(=O)CN<br /> (2)InChI: InChI=1S/C7H14N2O3/c1-4(2)6(7(11)12)9-5(10)3-8/h4,6H,3,8H2,1-2H3,(H,9,10)(H,11,12)<br /> (3)InChIKey: STKYPAFSDFAEPH-UHFFFAOYSA-N</p> </body> </html>