Products Categories
CAS No.: | 106388-34-5 |
---|---|
Name: | Monguine |
Molecular Structure: | |
Formula: | C32H36N2O13 |
Molecular Weight: | 656.63 |
Synonyms: | monguine |
The Monguine has the CAS registry number 106388-34-5. This chemical's molecular formula is C32H36N2O13 and molecular weight is 656.63. What's more, its IUPAC name is 5-[[6-[(3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl)oxy]-3-hydroxy-2-methyloxan-4-yl]amino]-2-amino-5-oxopentanoic acid. Its classification codes is Natural Product.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1C(C(CC(O1)OC2CC(CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)C)O)NC(=O)CCC(C(=O)O)N)O
(2)InChI: InChI=1S/C32H36N2O13/c1-12-26(37)17(34-20(36)8-7-16(33)31(42)43)9-21(46-12)47-19-11-32(44,13(2)35)10-15-23(19)30(41)25-24(28(15)39)27(38)14-5-4-6-18(45-3)22(14)29(25)40/h4-6,12,16-17,19,21,26,37,39,41,44H,7-11,33H2,1-3H3,(H,34,36)(H,42,43)
(3)InChIKey: SQUWGLCTNLPKFV-UHFFFAOYSA-N
The toxicity data is as follows:
Organism | Test Type | Route | Reported Dose (Normalized Dose) | Effect | Source |
---|---|---|---|---|---|
mouse | LD50 | parenteral | 12mg/kg (12mg/kg) | Biochimie. Vol. 68, Pg. 1225, 1986. |