Products Categories
| CAS No.: | 1189805-46-6 |
|---|---|
| Name: | 2-(Methylamino)-1-(4-methylphenyl)-1-propanone |
| Molecular Structure: | |
|
|
|
| Formula: | C11H15NO |
| Molecular Weight: | 177.246 |
| Synonyms: | mephedrone; |
| Density: | 0.987 g/cm3 |
| Melting Point: | 232℃ |
| Boiling Point: | 280.2 °C at 760 mmHg |
| Flash Point: | 109.6 °C |
| PSA: | 29.10000 |
| LogP: | 2.17650 |
This product is a nationally controlled contraband, and the Lookchem platform doesn't provide relevant sales information.
The 2-(Methylamino)-1-(4-methylphenyl)-1-propanone is an organic compound with the formula C11H15NO. The systematic name of this chemical is 2-(methylamino)-1-(p-tolyl)propan-1-one. With the CAS registry number 1189805-46-6, it is also named as 4-Methylmethcathinone.
Physical properties about 2-(Methylamino)-1-(4-methylphenyl)-1-propanone are: (1)ACD/LogP: 1.86; (2)ACD/LogD (pH 7.4): 1.55; (3)#H bond acceptors: 2; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 29.1 Å2; (7)Index of Refraction: 1.512; (8)Molar Refractivity: 53.92 cm3; (9)Molar Volume: 179.4 cm3; (10)Polarizability: 21.37×10-24cm3; (11)Surface Tension: 34.5 dyne/cm; (12)Density: 0.987 g/cm3; (13)Flash Point: 109.6 °C; (14)Enthalpy of Vaporization: 51.89 kJ/mol; (15)Boiling Point: 280.2 °C at 760 mmHg; (16)Vapour Pressure: 0.00384 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Cc1ccc(cc1)C(=O)C(C)NC
(2)InChI: InChI=1/C11H15NO/c1-8-4-6-10(7-5-8)11(13)9(2)12-3/h4-7,9,12H,1-3H3
(3)InChIKey: YELGFTGWJGBAQU-UHFFFAOYAO
(4)Std. InChI: InChI=1S/C11H15NO/c1-8-4-6-10(7-5-8)11(13)9(2)12-3/h4-7,9,12H,1-3H3
(5)Std. InChIKey: YELGFTGWJGBAQU-UHFFFAOYSA-N