Products Categories
CAS No.: | 125678-52-6 |
---|---|
Name: | Diethylaminopropyne formate |
Molecular Structure: | |
|
|
Formula: | C8H15NO2 |
Molecular Weight: | 111.187 |
Synonyms: | Diethylaminopropyne formic acid (PABS); |
Density: | 1.04 g/cm3 |
PSA: | 40.54000 |
LogP: | 1.29810 |
What can I do for you?
Get Best Price
The Diethylaminopropyne formate, with the CAS registry number 125678-52-6, is also known as Diethylprop-2-ynylamine, formic acid. This chemical's molecular formula is C8H15NO2 and molecular weight is 157.21. Its systematic name is called N,N-diethylprop-2-yn-1-amine; formic acid.
You can still convert the following datas into molecular structure:
(1)SMILES: CCN(CC)CC#C.C(=O)O
(2)InChI: InChI=1/C7H13N.CH2O2/c1-4-7-8(5-2)6-3;2-1-3/h1H,5-7H2,2-3H3;1H,(H,2,3)
(3)InChIKey: FZMMJXJELVVLLB-UHFFFAOYAO