Products Categories
| CAS No.: | 129558-76-5 |
|---|---|
| Name: | TOLFENPYRAD |
| Molecular Structure: | |
|
|
|
| Formula: | C21H22ClN3O2 |
| Molecular Weight: | 383.878 |
| Synonyms: | 4-Chloro-3-ethyl-1-methyl-N-[4-(p-tolyloxy)benzyl]pyrazole-5-carboxamide;4-Chloro-3-ethyl-1-methyl-N-[[4-(4-methylphenoxy)phenyl]methyl]-1H-pyrazole-5-carboxamide;Hachihachi EC;NAI 2302;OMI 88;Tolfenpyrad; |
| Density: | 1.216 g/cm3 |
| Melting Point: | 87~89℃ |
| Boiling Point: | 539.982 °C at 760 mmHg |
| Flash Point: | 280.371 °C |
| Hazard Symbols: | Xn,N |
| Risk Codes: | 20/22-50/53 |
| Safety: | 60-61 |
| PSA: | 56.15000 |
| LogP: | 5.05750 |
The Tolfenpyrad is an organic compound with the formula C21H22ClN3O2. The IUPAC name of this chemical is 4-chloro-5-ethyl-2-methyl-N-[[4-(4-methylphenoxy)phenyl]methyl]pyrazole-3-carboxamide. With the CAS registry number 129558-76-5, it is also named as 1H-Pyrazole-5-carboxamide, 4-chloro-3-ethyl-1-methyl-N-[[4-(4-methylphenoxy)phenyl]methyl]-.
Physical properties about Tolfenpyrad are: (1)ACD/LogP: 5.20; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5; (4)ACD/LogD (pH 7.4): 5; (5)ACD/BCF (pH 5.5): 1581; (6)ACD/BCF (pH 7.4): 1581; (7)ACD/KOC (pH 5.5): 6782; (8)ACD/KOC (pH 7.4): 6782; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 56.15 Å2; (13)Index of Refraction: 1.6; (14)Molar Refractivity: 108.032 cm3; (15)Molar Volume: 315.681 cm3; (16)Polarizability: 42.827×10-24cm3; (17)Surface Tension: 42.402 dyne/cm; (18)Density: 1.216 g/cm3; (19)Flash Point: 280.371 °C; (20)Enthalpy of Vaporization: 81.752 kJ/mol; (21)Boiling Point: 539.982 °C at 760 mmHg.
You can still convert the following datas into molecular structure:
(1)SMILES: Clc3c(nn(c3C(=O)NCc2ccc(Oc1ccc(cc1)C)cc2)C)CC
(2)InChI: InChI=1/C21H22ClN3O2/c1-4-18-19(22)20(25(3)24-18)21(26)23-13-15-7-11-17(12-8-15)27-16-9-5-14(2)6-10-16/h5-12H,4,13H2,1-3H3,(H,23,26)
(3)InChIKey: WPALTCMYPARVNV-UHFFFAOYAH
(4)Std. InChI: InChI=1S/C21H22ClN3O2/c1-4-18-19(22)20(25(3)24-18)21(26)23-13-15-7-11-17(12-8-15)27-16-9-5-14(2)6-10-16/h5-12H,4,13H2,1-3H3,(H,23,26)
(5)Std. InChIKey: WPALTCMYPARVNV-UHFFFAOYSA-N