Products Categories
CAS No.: | 14475-73-1 |
---|---|
Name: | Zirconium sulfate |
Molecular Structure: | |
Formula: | Zr(SO4)2 |
Molecular Weight: | 283.35 |
Synonyms: | Zirconium sulfate;Zirconium sulphate; |
EINECS: | 238-694-4 |
Melting Point: | 410℃ |
Boiling Point: | 330 °C at 760 mmHg |
Hazard Symbols: | R34:; |
Risk Codes: | C:Corrosive; "> C:Corrosive; |
The Sulfuric acid, zirconium salt, with the CAS registry number 14475-73-1, is also known as Zirconium(IV) sulfate (1:2). This chemical's molecular formula is Zr(SO4)2 and molecular weight is 283.3492. Its IUPAC name is called zirconium(4+) disulfate.
Physical properties of Sulfuric acid, zirconium salt: (1)ACD/LogP: -1.03; (2)ACD/LogD (pH 5.5): -5.53; (3)ACD/LogD (pH 7.4): -5.53; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 2; (8)Enthalpy of Vaporization: 62.94 kJ/mol; (9)Boiling Point: 330 °C at 760 mmHg; (10)Vapour Pressure: 3.35E-05 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Zr+4]
(2)InChI: InChI=1S/2H2O4S.Zr/c2*1-5(2,3)4;/h2*(H2,1,2,3,4);/q;;+4/p-4
(3)InChIKey: ZXAUZSQITFJWPS-UHFFFAOYSA-J