Products Categories
CAS No.: | 180-13-2 |
---|---|
Name: | 2-BROMO NAPHTHALCNE |
Molecular Structure: | |
Formula: | C10H7Br |
Molecular Weight: | 207.07 |
Synonyms: | Naphthalene, 2-bromo-;β-Bromonaphthalene; |
EINECS: | 209-452-5 |
Density: | 1.482 g/cm3 |
Melting Point: | 53-57℃ |
Boiling Point: | 282.677 °C at 760 mmHg |
Flash Point: | 127.817 °C |
Solubility: | slightly soluble |
Hazard Symbols: | R22:; R36:; |
Risk Codes: | Xn:Harmful; "> Xn:Harmful; |
PSA: | 0.00000 |
LogP: | 3.60230 |
The 2-Bromo naphthalene, with the CAS registry number 180-13-2, is also known as β-Bromonaphthalene. This chemical's molecular formula is C10H7Br and molecular weight is 207.07. What's more, its systematic name is 2-Bromonaphthalene.
Physical properties of 2-Bromo naphthalene are: (1)ACD/LogP: 4.12; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.12; (4)ACD/LogD (pH 7.4): 4.12; (5)ACD/BCF (pH 5.5): 796.71; (6)ACD/BCF (pH 7.4): 796.71; (7)ACD/KOC (pH 5.5): 4152.89; (8)ACD/KOC (pH 7.4): 4152.89; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Index of Refraction: 1.663; (13)Molar Refractivity: 51.786 cm3; (14)Molar Volume: 139.734 cm3; (15)Polarizability: 20.529×10-24cm3; (16)Surface Tension: 44.85 dyne/cm; (17)Density: 1.482 g/cm3; (18)Flash Point: 127.817 °C; (19)Enthalpy of Vaporization: 50.061 kJ/mol; (20)Boiling Point: 282.677 °C at 760 mmHg; (21)Vapour Pressure: 0.006 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Brc2ccc1c(cccc1)c2
(2)Std. InChI: InChI=1S/C10H7Br/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H
(3)Std. InChIKey: APSMUYYLXZULMS-UHFFFAOYSA-N