Products Categories
CAS No.: | 18635-55-7 |
---|---|
Name: | H-gly-arg-oh |
Article Data: | 5 |
Molecular Structure: | |
Formula: | C8H17N5O3 |
Molecular Weight: | 231.255 |
Synonyms: | Arginine,N2-glycyl- (6CI);Arginine, N2-glycyl-, L- (8CI);L-Arginine, N2-glycyl-;11:PN: US20030166162 SEQID: 11 unclaimed protein;1529: PN: EP2071334 SEQID: 1613claimed protein;1529: PN: WO2009077864 SEQID: 1613 claimed protein;1704: PN:WO2007124090 PAGE: 83 claimed protein;39: PN: WO03012122 SEQID: 103 claimedprotein;Glycyl-L-arginine;Glycylarginine;NSC 334212;H-Gly-Arg-OH; |
Density: | 1.51 g/cm3 |
PSA: | 154.32000 |
LogP: | 0.05990 |
The H-gly-arg-oh, with the CAS registry number 18635-55-7, is also known as NSC334212. This chemical's molecular formula is C8H17N5O3 and molecular weight is 231.25228. Its IUPAC name is called 2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoic acid.
Physical properties of H-gly-arg-oh: (1)ACD/LogP: -2.11; (2)# of Rule of 5 Violations: 1; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 8; (8)#H bond donors: 8; (9)#Freely Rotating Bonds: 8; (10)Index of Refraction: 1.62; (11)Molar Refractivity: 53.82 cm3; (12)Molar Volume: 153 cm3; (13)Surface Tension: 69 dyne/cm; (14)Density: 1.51 g/cm3.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C(CC(C(=O)O)NC(=O)CN)CN=C(N)N
(2)InChI: InChI=1S/C8H17N5O3/c9-4-6(14)13-5(7(15)16)2-1-3-12-8(10)11/h5H,1-4,9H2,(H,13,14)(H,15,16)(H4,10,11,12)
(3)InChIKey: JLXVRFDTDUGQEE-UHFFFAOYSA-N