Products Categories
| CAS No.: | 20197-80-2 |
|---|---|
| Name: | 2,4-Dihydroxy-6,7-diMethoxyquinazoline |
| Molecular Structure: | |
|
|
|
| Formula: | C12H14N2O4 |
| Molecular Weight: | 250.2506 |
| Synonyms: | 6,7-Diethoxy-2,4-dioxo-1,2,3,4-tetrahydro-chinazolin |
| EINECS: | 633-829-7 |
| Density: | 1.236 g/cm3 |
| PSA: | 84.18000 |
| LogP: | 1.01380 |
What can I do for you?
Get Best Price
Both the product name and systematic name of this chemical are the same which is called 6,7-Diethoxyquinazoline-2,4(1H,3H)-dione. With the CAS registry number 20197-80-2, it is also known as 6,7-Diethoxyquinazoline-2,4-diol. This chemical's molecular formula is C12H14N2O4 and molecular weight is 250.2506.
Physical properties of 6,7-Diethoxyquinazoline-2,4(1H,3H)-dione: (1)ACD/LogP: 1.69; (2)ACD/LogD (pH 5.5): 1.69; (3)ACD/LogD (pH 7.4): 1.69; (4)ACD/BCF (pH 5.5): 11.41; (5)ACD/BCF (pH 7.4): 11.37; (6)ACD/KOC (pH 5.5): 198.79; (7)ACD/KOC (pH 7.4): 198.08; (8)#H bond acceptors: 6; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.539; (12)Molar Refractivity: 63.39 cm3; (13)Molar Volume: 202.3 cm3; (14)Surface Tension: 42.5 dyne/cm; (15)Density: 1.236 g/cm3.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C2c1c(cc(OCC)c(OCC)c1)NC(=O)N2
(2)InChI: InChI=1/C12H14N2O4/c1-3-17-9-5-7-8(6-10(9)18-4-2)13-12(16)14-11(7)15/h5-6H,3-4H2,1-2H3,(H2,13,14,15,16)
(3)InChIKey: WIGJUGVJWIECFL-UHFFFAOYAW