Products Categories
CAS No.: | 22839-16-3 |
---|---|
Name: | H-D-TRP-OBZL HCL |
Article Data: | 9 |
Molecular Structure: | |
Formula: | C18H19ClN2O2 |
Molecular Weight: | 330.814 |
Synonyms: | Tryptophan, benzyl ester, monohydrochloride,D- (8CI); |
Melting Point: | 215 °C |
PSA: | 68.11000 |
LogP: | 4.28340 |
The D-Tryptophan, phenylmethyl ester, monohydrochloride (9CI), with the CAS registry number 22839-16-3, is also known as Amino Acid Benzyl Esters; Amino Acids; Amino Acids (C-Protected); Biochemistry. This chemical's molecular formula is C18H19ClN2O2 and molecular weight is 330.8087. Its systematic name is called benzyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate hydrochloride.
You can still convert the following datas into molecular structure:
(1)SMILES: c1ccc(cc1)COC(=O)[C@@H](Cc2c[nH]c3c2cccc3)N.Cl
(2)InChI: InChI=1/C18H18N2O2.ClH/c19-16(18(21)22-12-13-6-2-1-3-7-13)10-14-11-20-17-9-5-4-8-15(14)17;/h1-9,11,16,20H,10,12,19H2;1H/t16-;/m1./s1
(3)InChIKey: DOKDMGOWZOTZRA-PKLMIRHRBD
(4)Std. InChI: InChI=1S/C18H18N2O2.ClH/c19-16(18(21)22-12-13-6-2-1-3-7-13)10-14-11-20-17-9-5-4-8-15(14)17;/h1-9,11,16,20H,10,12,19H2;1H/t16-;/m1./s1
(5)Std. InChIKey: DOKDMGOWZOTZRA-PKLMIRHRSA-N