Products Categories
CAS No.: | 2480-26-4 |
---|---|
Name: | H-L-MESER-OH HCL |
Article Data: | 5 |
Molecular Structure: | |
Formula: | C4H9NO3 |
Molecular Weight: | 119.11900 |
Synonyms: | (S)-3-Hydroxy-2-methylaminopropionic acid;Serine,N-methyl-, L- (8CI);N-Methyl-(S)-serine; |
EINECS: | 200-258-5 |
Density: | 1.242 g/cm3 |
Melting Point: | 190℃ (dec.) |
Boiling Point: | 326.2 °C at 760 mmHg |
Flash Point: | 151.1 °C |
Hazard Symbols: | Xi |
Risk Codes: | 36 |
Safety: | 26 |
The L-Serine, N-methyl-, with the CAS registry number 2480-26-4, is also known as Serine, N-methyl-, L-. This chemical's molecular formula is C4H9NO3 and molecular weight is 119.1192. Its systematic name is called (2S)-3-hydroxy-2-(methylammonio)propanoate.
Physical properties of L-Serine, N-methyl-: (1)ACD/LogP: -1.24; (2)ACD/LogD (pH 5.5): -3.74; (3)ACD/LogD (pH 7.4): -3.75; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.479; (12)Molar Refractivity: 27.23 cm3; (13)Molar Volume: 95.8 cm3; (14)Surface Tension: 50.1 dyne/cm; (15)Density: 1.242 g/cm3; (16)Flash Point: 151.1 °C; (17)Enthalpy of Vaporization: 65.87 kJ/mol; (18)Boiling Point: 326.2 °C at 760 mmHg; (19)Vapour Pressure: 1.68E-05 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: [O-]C(=O)[C@@H]([NH2+]C)CO
(2)InChI: InChI=1/C4H9NO3/c1-5-3(2-6)4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m0/s1
(3)InChIKey: PSFABYLDRXJYID-VKHMYHEABC