Products Categories
CAS No.: | 262-05-5 |
---|---|
Name: | 10H-Phenoselenazine |
Article Data: | 15 |
Molecular Structure: | |
Formula: | C10H9NSe |
Molecular Weight: | 246.17 |
Synonyms: | Phenoselenazine;2-Phenyl-2H-1,2-selenazine; |
Boiling Point: | 307.5 °C at 760 mmHg |
Flash Point: | 139.8 °C |
PSA: | 12.03000 |
LogP: | 1.53660 |
The 10H-Phenoselenazine, with the CAS registry number 262-05-5, is also known as Phenoselenazine. This chemical's molecular formula is C10H9NSe and molecular weight is 222.15. What's more, its systematic name is 2-Phenyl-2H-1,2-selenazine.
Physical properties of 10H-Phenoselenazine are: (1)#H bond acceptors: 1; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 1; (4)Flash Point: 139.8 °C; (5)Enthalpy of Vaporization: 54.81 kJ/mol; (6)Boiling Point: 307.5 °C at 760 mmHg; (7)Vapour Pressure: 0.000723 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(ccc1)N2/C=C\C=C/[Se]2
(2)InChI: InChI=1/C10H9NSe/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-9H
(3)InChIKey: AMIHNKVWMLRIQC-UHFFFAOYAW