Products Categories
| CAS No.: | 28948-60-9 |
|---|---|
| Name: | 2-bromothieno[3,2-c]pyridin-4(5H)-one |
| Molecular Structure: | |
|
|
|
| Formula: | C7H4BrNOS |
| Molecular Weight: | 230.085 |
| Synonyms: | Thieno[3,2-c]pyridin-4(5H)-one, 2-bromo-; |
| EINECS: | 604-604-1 |
| Density: | 1.801 g/cm3 |
| Boiling Point: | 461.674 °C at 760 mmHg |
| Flash Point: | 233.012 °C |
| PSA: | 61.10000 |
| LogP: | 2.35210 |
What can I do for you?
Get Best Price
The 2-Bromothieno[3,2-c]pyridin-4(5H)-one, with the CAS registry number 28948-60-9, is also known as Thieno[3,2-c]pyridin-4(5H)-one, 2-bromo-. This chemical's molecular formula is C7H4BrNOS and molecular weight is 230.0818. Its IUPAC name is called 2-bromo-5H-thieno[3,2-c]pyridin-4-one.
Physical properties of 2-Bromothieno[3,2-c]pyridin-4(5H)-one: (1)ACD/LogP: 2.60; (2)ACD/LogD (pH 5.5): 2.601; (3)ACD/LogD (pH 7.4): 2.601; (4)ACD/BCF (pH 5.5): 55.819; (5)ACD/BCF (pH 7.4): 55.818; (6)ACD/KOC (pH 5.5): 619.381; (7)ACD/KOC (pH 7.4): 619.37; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)Index of Refraction: 1.668; (11)Molar Refractivity: 47.584 cm3; (12)Molar Volume: 127.751 cm3; (13)Surface Tension: 56.006 dyne/cm; (14)Density: 1.801 g/cm3; (15)Flash Point: 233.012 °C; (16)Enthalpy of Vaporization: 72.258 kJ/mol; (17)Boiling Point: 461.674 °C at 760 mmHg; (18)Vapour Pressure: 0 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CNC(=O)C2=C1SC(=C2)Br
(2)InChI: InChI=1S/C7H4BrNOS/c8-6-3-4-5(11-6)1-2-9-7(4)10/h1-3H,(H,9,10)
(3)InChIKey: ZDUWCUXIWRAXLF-UHFFFAOYSA-N