Products Categories
CAS No.: | 2990-19-4 |
---|---|
Name: | calcium oxoacetate |
Molecular Structure: | |
Formula: | C2H2O3.1/2Ca |
Molecular Weight: | 113.11 |
Synonyms: | Glyoxylicacid, calcium salt (8CI);Calcium glyoxylate; |
EINECS: | 221-059-0 |
Density: | 1.384 g/cm3 |
Boiling Point: | 224.6 °C at 760 mmHg |
Flash Point: | 103.9 °C |
PSA: | 114.40000 |
LogP: | -4.12960 |
The Acetic acid, oxo-,calcium salt (9CI) with CAS registry number of 2990-19-4 is also known as Glyoxylicacid, calcium salt (8CI). The IUPAC name is Calcium oxaldehydate. Its EINECS registry number is 221-059-0. In addition, the formula is C2H2O3.1/2Ca and the molecular weight is 113.11.
Physical properties about Acetic acid, oxo-,calcium salt (9CI) are: (1)ACD/LogP: -0.93; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -3.76; (4)ACD/LogD (pH 7.4): -4.64; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 54.37Å2; (13)Flash Point: 103.9 °C; (14)Enthalpy of Vaporization: 50.8 kJ/mol; (15)Boiling Point: 224.6 °C at 760 mmHg; (16)Vapour Pressure: 0.0331 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
1. SMILES: [Ca+2].[O-]C(=O)C=O
2. InChI: InChI=1/C2H2O3.Ca/c3-1-2(4)5;/h1H,(H,4,5);/q;+2/p-1
3. InChIKey:VJHAENFJBNQADO-REWHXWOFAI
4. Std. InChI: InChI=1S/C2H2O3.Ca/c3-1-2(4)5;/h1H,(H,4,5);/q;+2/p-1
5. Std. InChIKey: VJHAENFJBNQADO-UHFFFAOYSA-M