Products Categories
| CAS No.: | 369-24-4 |
|---|---|
| Name: | 2-Fluoroisoniazide |
| Molecular Structure: | |
|
|
|
| Formula: | C6H6 F N3 O |
| Molecular Weight: | 155.132 |
| Synonyms: | Isonicotinicacid, 2-fluoro-, hydrazide (8CI); INHd 43; NSC 280613 |
| Density: | 1.356 g/cm3 |
| Boiling Point: | °Cat760mmHg |
| Flash Point: | °C |
| Appearance: | off white powder |
| PSA: | 68.01000 |
| LogP: | 0.91540 |
Molecular Structure of 2-Fluoroisoniazide (CAS NO.369-24-4):
.png)
IUPAC Name: 2-fluoropyridine-4-carbohydrazide
Empirical Formula: C6H6FN3O
Molecular Weight: 155.1297
H bond acceptors: 4
H bond donors: 3
Freely Rotating Bonds: 2
Polar Surface Area: 36.44 Å2
Index of Refraction: 1.557
Molar Refractivity: 36.86 cm3
Molar Volume: 114.3 cm3
Surface Tension: 54.6 dyne/cm
Density: 1.356 g/cm3
SMILES: O=C(c1ccnc(F)c1)NN
InChI: InChI=1/C6H6FN3O/c7-5-3-4(1-2-9-5)6(11)10-8/h1-3H,8H2,(H,10,11)
2-Fluoroisoniazide , with CAS number of 369-24-4, can be called 4-pyridinecarboxylic acid, 2-fluoro-, hydrazide ; 2-fluoroisonicotinic acid hydrazide ; 2-fluoropyridine-4-carbohydrazide ; Isoniazid analog ; Pyridine, 2-fluoro-4-carboxylic acid, hydrazide .