Products Categories
CAS No.: | 37723-78-7 |
---|---|
Name: | iopronic acid |
Molecular Structure: | |
|
|
Formula: | C15H18 I3 N O5 |
Molecular Weight: | 673.025 |
Synonyms: | Bilimiro;Iopronic acid;Oravue; |
EINECS: | 253-643-6 |
Density: | 2.149g/cm3 |
Melting Point: | 130°C |
Boiling Point: | 674.2°Cat760mmHg |
Flash Point: | 361.5°C |
Solubility: | 20.08g/L(37 oC) |
Safety: | Moderately toxic by ingestion and intravenous routes. Experimental reproductive effects. When heated to decomposition it emits very toxic fumes of I− and NOx. |
PSA: | 84.86000 |
LogP: | 4.03800 |
Empirical Formula of Iopronic acid (CAS NO.37723-78-7): C15H18I3NO5
Molecular Weight: 673.0205 g/mol
EINECS: 253-643-6
Index of Refraction: 1.67
Density: 2.149 g/cm3
Flash Point: 361.5 °C
Enthalpy of Vaporization: 104.01 kJ/mol
Boiling Point: 674.2 °C at 760 mmHg
Vapour Pressure: 4.26E-19 mmHg at 25 °C
Structure of Iopronic acid (CAS NO.37723-78-7):
IUPAC Name: 2-[2-(3-Acetamido-2,4,6-triiodophenoxy)ethoxymethyl]butanoic acid
Canonical SMILES: CCC(COCCOC1=C(C=C(C(=C1I)NC(=O)C)I)I)C(=O)O
InChI: InChI=1S/C15H18I3NO5/c1-3-9(15(21)22)7-23-4-5-24-14-11(17)6-10(16)13(12(14)18)19-8(2)20/h6,9H,3-5,7H2,1-2H3,(H,19,20)(H,21,22)
InChIKey: YMFIJXDFAPHJIN-UHFFFAOYSA-N
1. | orl-rat LD50:5650 mg/kg | FRPPAO Farmaco, Edizione Pratica. 31 (1976),397. | ||
2. | ivn-rat LD50:1 g/kg | MEIEDD Merck Index. 10 (1983),732. | ||
3. | orl-mus LD50:1950 mg/kg | FRPPAO Farmaco, Edizione Pratica. 31 (1976),397. | ||
4. | ivn-mus LD50:1090 mg/kg | 43FLAV Burgers Medicinal Chemistry. 4 (3)(1980),1153. | ||
5. | ivn-dog LD50:835 mg/kg | MEIEDD Merck Index. 10 (1983),732. |
Moderately toxic by ingestion and intravenous routes. Experimental reproductive effects. When heated to decomposition Iopronic acid (CAS NO.37723-78-7) emits very toxic fumes of I− and NOx.
Iopronic acid , its cas register number is 37723-78-7. It also can be called Bilimiro ; (+-)-2-((2-(3-Acetamido-2,4,6-
triiodophenoxy)ethoxy)methyl)butyric acid ; and 2((3-Acetamino-2,4,6-triiodophenoxy)-2-ethoxy)methylbutyric acid .