Products Categories
| CAS No.: | 430-64-8 |
|---|---|
| Name: | CF2=C=CH2 |
| Molecular Structure: | |
|
|
|
| Formula: | C3H2F2 |
| Molecular Weight: | 76.0457 |
| Synonyms: | Propadiene,1,1-difluoro- (6CI,7CI,8CI);1,1-Difluoroallene; |
| Density: | 0.921 g/cm3 |
| PSA: | 0.00000 |
| LogP: | 1.55170 |
This chemical is called 1,2-Propadiene,1,1-difluoro- (9CI), and its systematic name is 1,1-difluoropropadiene. With the molecular formula of C3H2F2, its molecular weight is 76.044786. The CAS registry number of this chemical is 430-64-8.
Other characteristics of the 1,2-Propadiene,1,1-difluoro- (9CI) can be summarised as followings: (1)ACD/LogP: 1.38; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.38; (4)ACD/LogD (pH 7.4): 1.38; (5)ACD/BCF (pH 5.5): 6.62; (6)ACD/BCF (pH 7.4): 6.62; (7)ACD/KOC (pH 5.5): 134.58; (8)ACD/KOC (pH 7.4): 134.58; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Index of Refraction: 1.308; (13)Molar Refractivity: 15.82 cm3; (14)Molar Volume: 82.4 cm3; (15)Polarizability: 6.27×10-24cm3; (16)Surface Tension: 3.6 dyne/cm; (17)Density: 0.921 g/cm3; (18)Enthalpy of Vaporization: 21.6 kJ/mol; (19)Vapour Pressure: 4590 mmHg at 25°C.
You can still convert the following datas into molecular structure:
1.SMILES: F\C(F)=C=C
2.InChI: InChI=1/C3H2F2/c1-2-3(4)5/h1H2
3.InChIKey: WKKSFZGDAZPYQO-UHFFFAOYAW