Products Categories
| CAS No.: | 447-40-5 |
|---|---|
| Name: | 1-Propanone, 1-(4-fluorophenyl)-2-(methylamino)- |
| Molecular Structure: | |
|
|
|
| Formula: | C10H12FNO |
| Molecular Weight: | 181.21 |
| Synonyms: | 4-Flephedrone;4'-Fluoromethcathinone; |
| Density: | 1.083 g/cm3 |
| Boiling Point: | 267.731 °C at 760 mmHg |
| Flash Point: | 115.72 °C |
This product is a nationally controlled contraband, and the Lookchem platform doesn't provide relevant sales information.
The Flephedrone, with the CAS registry number 447-40-5, is also known as 4-Flephedrone. This chemical's molecular formula is C10H12FNO and molecular weight is 181.21. What's more, its systematic name is 1-(4-Fluorophenyl)-2-(methylamino)-1-propanone. This chemical is a stimulant drug of the cathinone chemical class.
Physical properties of Flephedrone are: (1)ACD/LogP: 1.45; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.28; (4)ACD/LogD (pH 7.4): 1.22; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 4.42; (7)ACD/KOC (pH 5.5): 2.75; (8)ACD/KOC (pH 7.4): 86.95; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 29.1 Å2; (13)Index of Refraction: 1.498; (14)Molar Refractivity: 49.094 cm3; (15)Molar Volume: 167.38 cm3; (16)Polarizability: 19.462×10-24cm3; (17)Surface Tension: 34.1 dyne/cm; (18)Density: 1.083 g/cm3; (19)Flash Point: 115.72 °C; (20)Enthalpy of Vaporization: 50.577 kJ/mol; (21)Boiling Point: 267.731 °C at 760 mmHg; (22)Vapour Pressure: 0.008 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: CC(C(=O)c1ccc(cc1)F)NC
(2)Std. InChI: InChI=1S/C10H12FNO/c1-7(12-2)10(13)8-3-5-9(11)6-4-8/h3-7,12H,1-2H3
(3)Std. InChIKey: MWKQPIROPJSFRI-UHFFFAOYSA-N