Products Categories
CAS No.: | 53833-30-0 |
---|---|
Name: | FEMA 3672 |
Article Data: | 3 |
Cas Database | |
Molecular Structure: | |
|
|
Formula: | C7H11NO |
Molecular Weight: | 125.17 |
Synonyms: | 2-Ethyl-4,5-dimethyloxazole;4,5-Dimethyl-2-ethyloxazole; |
EINECS: | 258-815-4 |
Density: | 0.956 g/cm3 |
Boiling Point: | 166.4 °C at 760 mmHg |
Flash Point: | 57.7 °C |
Risk Codes: | 36 |
Safety: | 26 |
PSA: | 26.03000 |
LogP: | 1.85380 |
The 2-Ethyl-4,5-dimethyloxazole, with the CAS registry number 53833-30-0, is also known as 4,5-Dimethyl-2-ethyloxazole. Its EINECS registry number is 258-815-4. This chemical's molecular formula is C7H11NO and molecular weight is 125.084064. Its IUPAC name is called 2-ethyl-4,5-dimethyl-1,3-oxazole.
Physical properties of 2-Ethyl-4,5-dimethyloxazole: (1)ACD/LogP: 1.62; (2)ACD/LogD (pH 5.5): 1.62; (3)ACD/LogD (pH 7.4): 1.62; (4)ACD/BCF (pH 5.5): 9.94; (5)ACD/BCF (pH 7.4): 10.07; (6)ACD/KOC (pH 5.5): 179.42; (7)ACD/KOC (pH 7.4): 181.76; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.46; (11)Molar Refractivity: 35.84 cm3; (12)Molar Volume: 130.8 cm3; (13)Surface Tension: 30.4 dyne/cm; (14)Density: 0.956 g/cm3; (15)Flash Point: 57.7 °C; (16)Enthalpy of Vaporization: 38.63 kJ/mol; (17)Boiling Point: 166.4 °C at 760 mmHg; (18)Vapour Pressure: 2.36 mmHg at 25°C.
Preparation: this chemical can be prepared by propionyl chloride and butan-2-one (E)-oxime. The reaction temperature is 80 - 135 °C. The yield is about 85%.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCC1=NC(=C(O1)C)C
(2)InChI: InChI=1S/C7H11NO/c1-4-7-8-5(2)6(3)9-7/h4H2,1-3H3
(3)InChIKey: LCYOFVYHDBWYSI-UHFFFAOYSA-N