Products Categories
| CAS No.: | 607-23-8 |
|---|---|
| Name: | 2-NITRO-1-NAPHTHYLAMINE |
| Molecular Structure: | |
|
|
|
| Formula: | C10H8N2O2 |
| Molecular Weight: | 188.186 |
| Synonyms: | 1-Naphthylamine,2-nitro- (7CI,8CI);1-Amino-2-nitronaphthalene;2-Nitro-1-naphthylamine;NSC167919; |
| Density: | 1.366 g/cm3 |
| Melting Point: | 143 °C(Solv: ethanol (64-17-5)) |
| Boiling Point: | 390.8 °C at 760 mmHg |
| Flash Point: | 190.2 °C |
| PSA: | 71.84000 |
| LogP: | 3.43460 |
What can I do for you?
Get Best Price
The 1-Naphthalenamine,2-nitro-, with the CAS registry number 607-23-8, is also known as 2-Nitro-naphthalen-1-ylamine. This chemical's molecular formula is C10H8N2O2 and molecular weight is 188.18272. Its IUPAC name is called 2-nitronaphthalen-1-amine.
Physical properties of 1-Naphthalenamine,2-nitro-: (1)ACD/LogP: 3.06; (2)#H bond acceptors: 4; (3)#H bond donors: 2; (4)#Freely Rotating Bonds: 2; (5)Index of Refraction: 1.728; (6)Molar Refractivity: 54.87 cm3; (7)Molar Volume: 137.6 cm3; (8)Surface Tension: 66 dyne/cm; (9)Density: 1.366 g/cm3; (10)Flash Point: 190.2 °C; (11)Enthalpy of Vaporization: 64.04 kJ/mol; (12)Boiling Point: 390.8 °C at 760 mmHg; (13)Vapour Pressure: 2.57E-06 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C2C(=C1)C=CC(=C2N)[N+](=O)[O-]
(2)InChI: InChI=1S/C10H8N2O2/c11-10-8-4-2-1-3-7(8)5-6-9(10)12(13)14/h1-6H,11H2
(3)InChIKey: SMAJHKXZBICXLS-UHFFFAOYSA-N