Products Categories
| CAS No.: | 60871-84-3 |
|---|---|
| Name: | Nickel(II)trifluoromethanesulfonate,min.98%(Nickeltriflate) |
| Molecular Structure: | |
|
|
|
| Formula: | C2F6NiO6S2 |
| Molecular Weight: | 356.82 |
| Synonyms: | Nickel(II) trifluoromethanesulfonate; |
| Melting Point: | 100-106℃ |
| Boiling Point: | 162 °C at 760 mmHg |
| Solubility: | Partly soluble in water. |
| Hazard Symbols: |
C
|
| Risk Codes: | 45-36/37/38-43 |
| Safety: | 36/37/39 |
| PSA: | 131.16000 |
| LogP: | 2.26440 |
What can I do for you?
Get Best Price
The Nickel(II) trifluoromethanesulfonate with its cas register number is 60871-84-3. It also can be called as Nickel(II)trifluoromethanesulfonate,min.98%(Nickeltriflate) and the Systematic name about this chemical is nickel(2+) bis(trifluoromethanesulfonate).
Physical properties about Nickel(II) trifluoromethanesulfonate are: (1)ACD/LogP: -0.37; (2)ACD/LogD (pH 5.5): -4; (3)ACD/LogD (pH 7.4): -4; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)Polar Surface Area: 62.75Å2; (11)Vapour Pressure: 1.14 mmHg at 25°C
You can still convert the following datas into molecular structure:
(1)SMILES: [Ni+2].FC(F)(F)S([O-])(=O)=O.FC(F)(F)S([O-])(=O)=O
(2)InChI: InChI=1/2CHF3O3S.Ni/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2
(3)InChIKey: KVRSDIJOUNNFMZ-NUQVWONBAL
(4)Std. InChI: InChI=1S/2CHF3O3S.Ni/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2
(5)Std. InChIKey: KVRSDIJOUNNFMZ-UHFFFAOYSA-L