Products Categories
| CAS No.: | 61367-40-6 |
|---|---|
| Name: | H-D-CHG-OH HCL |
| Molecular Structure: | |
|
|
|
| Formula: | C8H16ClNO2 |
| Molecular Weight: | 193.674 |
| Synonyms: | Cyclohexaneaceticacid, a-amino-, hydrochloride, (R)-;Cyclohexaneacetic acid, a-amino-, hydrochloride, (aR)- (9CI);(R)-(Amino)(cyclohexyl)ethanoic acid hydrochloride;(R)-a-Aminocyclohexaneacetic acidhydrochloride;D-Cyclohexylglycine hydrochloride;N-Cyclohexylglycine hydrochloride (1:1); |
| Melting Point: | >220oC |
| Boiling Point: | 322.7 °C at 760 mmHg |
| Flash Point: | 149 °C |
| Appearance: | white - off-white powder |
| PSA: | 49.33000 |
| LogP: | 2.18620 |
The CAS register number of N-Cyclohexylglycine hydrochloride (1:1) is 61367-40-6. It also can be called as Cyclohexaneacetic acid,a-amino-, hydrochloride (1:1), (aR)- and the IUPAC name about this chemical is 2-(cyclohexylamino)acetic acid hydrochloride. The molecular formula about this chemical is C8H16ClNO2 and the molecular weight is 193.67.
Physical properties about N-Cyclohexylglycine hydrochloride (1:1) are: (1)ACD/LogP: 1.27; (2)ACD/LogD (pH 5.5): ; (3)ACD/LogD (pH 7.4): ; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 3; (11)Polar Surface Area: 49.33Å2; (12)Flash Point: 149 °C; (13)Enthalpy of Vaporization: 62.07 kJ/mol; (14)Boiling Point: 322.7 °C at 760 mmHg; (15)Vapour Pressure: 5.63E-05 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Cl.OC(=O)CNC1CCCCC1
(2)InChI: InChI=1/C8H15NO2.ClH/c10-8(11)6-9-7-4-2-1-3-5-7;/h7,9H,1-6H2,(H,10,11);1H
(3)InChIKey: QVQWXSBOYDWWPU-UHFFFAOYAK
(4)Std. InChI: InChI=1S/C8H15NO2.ClH/c10-8(11)6-9-7-4-2-1-3-5-7;/h7,9H,1-6H2,(H,10,11);1H
(5)Std. InChIKey: QVQWXSBOYDWWPU-UHFFFAOYSA-N