Products Categories
| CAS No.: | 616-40-0 |
|---|---|
| Name: | N,N-DIETHYLHYDRAZINE |
| Molecular Structure: | |
|
|
|
| Formula: | C4H12N2 |
| Molecular Weight: | 88.1527 |
| Synonyms: | N,N-Diethylhydrazine;1,1-Diethylhydrazine; |
| Density: | 0.835 g/cm3 |
| Boiling Point: | 119 °C at 760 mmHg |
| Flash Point: | 22.8 °C |
| PSA: | 29.26000 |
| LogP: | 0.90220 |
The Hydrazine, 1,1-diethyl-, with the CAS registry number 616-40-0, is also known as Diethylhydrazine. This chemical's molecular formula is C4H12N2 and molecular weight is 88.15. What's more, its IUPAC name is 1,1-Diethylhydrazine.
Physical properties of Hydrazine, 1,1-diethyl- are: (1)ACD/LogP: -0.22; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2.83; (4)ACD/LogD (pH 7.4): -1.15; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 2.12; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 6.48 Å2; (13)Index of Refraction: 1.44; (14)Molar Refractivity: 27.83 cm3; (15)Molar Volume: 105.4 cm3; (16)Polarizability: 11.03×10-24 cm3; (17)Surface Tension: 29.5 dyne/cm; (18)Density: 0.835 g/cm3; (19)Flash Point: 22.8 °C; (20)Enthalpy of Vaporization: 35.72 kJ/mol; (21)Boiling Point: 119 °C at 760 mmHg; (22)Vapour Pressure: 16.3 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCN(CC)N
(2)InChI: InChI=1S/C4H12N2/c1-3-6(5)4-2/h3-5H2,1-2H3
(3)InChIKey: IFZHGQSUNAKKSN-UHFFFAOYSA-N