Products Categories
| CAS No.: | 6949-87-7 |
|---|---|
| Name: | cis-Hexahydroisoindole hydrochloride |
| Molecular Structure: | |
|
|
|
| Formula: | C8H15N.HCl |
| Molecular Weight: | 161.67 |
| Synonyms: | 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole hydrochloride; |
| Melting Point: | 123-125 °C |
| PSA: | 12.03000 |
| LogP: | 2.30280 |
What can I do for you?
Get Best Price
The cis-Hexahydroisoindole hydrochloride with the CAS number 6949-87-7 is also called 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole hydrochloride. Its molecular formula is C8H15N.HCl. The cis-Hexahydroisoindole hydrochloride should be stored in dry and cool environment.
You can still convert the following datas into molecular structure:
(1)SMILES: C1CCC2CNCC2C1.Cl
(2)InChI: InChI=1/C8H15N.ClH/c1-2-4-8-6-9-5-7(8)3-1;/h7-9H,1-6H2;1H
(3)InChIKey: CLQIZUYXKFTUEB-UHFFFAOYAV