Products Categories
| CAS No.: | 830-94-4 |
|---|---|
| Name: | 5-CHLOROGRAMINE |
| Molecular Structure: | |
|
|
|
| Formula: | C11H13ClN2 |
| Molecular Weight: | 208.69 |
| Synonyms: | 5-Chlorogramine;5-Chloro-3-[(dimethylamino)methyl]indole; |
| Density: | 1.225 g/cm3 |
| Boiling Point: | 327.421 °C at 760 mmHg |
| Flash Point: | 151.819 °C |
| PSA: | 19.03000 |
| LogP: | 2.88290 |
The 1H-Indole-3-methanamine,5-chloro-N,N-dimethyl-, with the CAS registry number 830-94-4, is also known as 5-Chlorogramine. This chemical's molecular formula is C11H13ClN2 and molecular weight is 208.69. What's more, its systematic name is 1-(5-chloro-1H-indol-3-yl)-N,N-dimethylmethanamine.
Physical properties of 1H-Indole-3-methanamine,5-chloro-N,N-dimethyl- are: (1)ACD/LogP: 2.91; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 3; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 27; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 19.03 Å2; (12)Index of Refraction: 1.639; (13)Molar Refractivity: 61.327 cm3; (14)Molar Volume: 170.4 cm3; (15)Polarizability: 24.312×10-24cm3; (16)Surface Tension: 48.056 dyne/cm; (17)Density: 1.225 g/cm3; (18)Flash Point: 151.819 °C; (19)Enthalpy of Vaporization: 56.972 kJ/mol; (20)Boiling Point: 327.421 °C at 760 mmHg; (21)Vapour Pressure: 0 mmHg at 25°C.
Uses of 1H-Indole-3-methanamine,5-chloro-N,N-dimethyl-: it can be used to produce 5-chloro-3-(1H-imidazol-1-ylmethyl)-1H-indole by heating. This reaction will need solvent xylene with the reaction time of 3 hours. The yield is about 84%.

You can still convert the following datas into molecular structure:
(1)SMILES: CN(C)Cc2cnc1ccc(Cl)cc12
(2)Std. InChI: InChI=1S/C11H13ClN2/c1-14(2)7-8-6-13-11-4-3-9(12)5-10(8)11/h3-6,13H,7H2,1-2H3
(3)Std. InChIKey: ILGPJIAGKMKHPE-UHFFFAOYSA-N